C21H30F2O2 — CID 126727490
(3Z,5Z)-6-[[4-(4-ethenylcyclohexyl)cyclohexyl]methoxy]-4,5-difluorohexa-1,3,5-trien-3-ol (PubChem CID 126727490) has the molecular formula C21H30F2O2 and a molecular weight of 352.47 g/mol. Its IUPAC name is (3Z,5Z)-6-[[4-(4-ethenylcyclohexyl)cyclohexyl]methoxy]-4,5-difluorohexa-1,3,5-trien-3-ol.
| Compound Name | (3Z,5Z)-6-[[4-(4-ethenylcyclohexyl)cyclohexyl]methoxy]-4,5-difluorohexa-1,3,5-trien-3-ol |
|---|---|
| PubChem CID | 126727490 |
| Molecular Formula | C21H30F2O2 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | (3Z,5Z)-6-[[4-(4-ethenylcyclohexyl)cyclohexyl]methoxy]-4,5-difluorohexa-1,3,5-trien-3-ol |
| SMILES | C=C/C(O)=C(F)\C(F)=C\OCC1CCC(C2CCC(C=C)CC2)CC1 |
| InChI | InChI=1S/C21H30F2O2/c1-3-15-5-9-17(10-6-15)18-11-7-16(8-12-18)13-25-14-19(22)21(23)20(24)4-2/h3-4,14-18,24H,1-2,5-13H2/b19-14-,21-20- |
| InChIKey | PCZKFKOBOQNUJM-BNBRPOPKSA-N |
| XLogP | 6.54 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|