C6H10F2O2 — CID 154100559
1,1-diethoxy-2,2-difluoroethene (PubChem CID 154100559) has the molecular formula C6H10F2O2 and a molecular weight of 152.14 g/mol. Its IUPAC name is 1,1-diethoxy-2,2-difluoroethene.
| Compound Name | 1,1-diethoxy-2,2-difluoroethene |
|---|---|
| PubChem CID | 154100559 |
| Molecular Formula | C6H10F2O2 |
| Molecular Weight | 152.14 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | 1,1-diethoxy-2,2-difluoroethene |
| SMILES | CCOC(OCC)=C(F)F |
| InChI | InChI=1S/C6H10F2O2/c1-3-9-6(5(7)8)10-4-2/h3-4H2,1-2H3 |
| InChIKey | HWUJOPOPMJXYHI-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.14 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|