About (Z)-1-chloro-1,2-diethoxy-2-fluoroethene
(Z)-1-chloro-1,2-diethoxy-2-fluoroethene (PubChem CID 134893818) has the molecular formula C6H10ClFO2
and a molecular weight of 168.59 g/mol. Its IUPAC name is (Z)-1-chloro-1,2-diethoxy-2-fluoroethene.
Molecular Properties
| Compound Name | (Z)-1-chloro-1,2-diethoxy-2-fluoroethene |
| PubChem CID | 134893818 |
| Molecular Formula | C6H10ClFO2 |
| Molecular Weight | 168.59 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | (Z)-1-chloro-1,2-diethoxy-2-fluoroethene |
| SMILES | CCO/C(F)=C(/Cl)OCC |
| InChI | InChI=1S/C6H10ClFO2/c1-3-9-5(7)6(8)10-4-2/h3-4H2,1-2H3/b6-5- |
| InChIKey | JHLGZRZZHFGTQA-WAYWQWQTSA-N |
| XLogP | 2.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.59 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-chloro-1,2-diethoxy-2-fluoroethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-chloro-1,2-diethoxy-2-fluoroethene?
The IUPAC name of (Z)-1-chloro-1,2-diethoxy-2-fluoroethene (CID 134893818) is (Z)-1-chloro-1,2-diethoxy-2-fluoroethene.
What is the SMILES notation for (Z)-1-chloro-1,2-diethoxy-2-fluoroethene?
The canonical SMILES for (Z)-1-chloro-1,2-diethoxy-2-fluoroethene is CCO/C(F)=C(/Cl)OCC.
What is the InChIKey of (Z)-1-chloro-1,2-diethoxy-2-fluoroethene?
The InChIKey is JHLGZRZZHFGTQA-WAYWQWQTSA-N. The full InChI is InChI=1S/C6H10ClFO2/c1-3-9-5(7)6(8)10-4-2/h3-4H2,1-2H3/b6-5-.
What are the key properties of (Z)-1-chloro-1,2-diethoxy-2-fluoroethene?
(Z)-1-chloro-1,2-diethoxy-2-fluoroethene has a molecular weight of 168.59 g/mol, XLogP of 2.39, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-chloro-1,2-diethoxy-2-fluoroethene is sourced from PubChem (CID 134893818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).