C10H18O4 — CID 50897516
(1Z,5Z)-1,6-diethoxyhexa-1,5-diene-1,6-diol (PubChem CID 50897516) has the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. Its IUPAC name is (1Z,5Z)-1,6-diethoxyhexa-1,5-diene-1,6-diol.
| Compound Name | (1Z,5Z)-1,6-diethoxyhexa-1,5-diene-1,6-diol |
|---|---|
| PubChem CID | 50897516 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | (1Z,5Z)-1,6-diethoxyhexa-1,5-diene-1,6-diol |
| SMILES | CCO/C(O)=C\CC/C=C(/O)OCC |
| InChI | InChI=1S/C10H18O4/c1-3-13-9(11)7-5-6-8-10(12)14-4-2/h7-8,11-12H,3-6H2,1-2H3/b9-7-,10-8- |
| InChIKey | GICZHJVPKSTMOJ-XOHWUJONSA-N |
| XLogP | 2.64 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|