C7H14O3 — CID 162291132
1-ethoxypent-1-ene-1,3-diol (PubChem CID 162291132) has the molecular formula C7H14O3 and a molecular weight of 146.19 g/mol. Its IUPAC name is 1-ethoxypent-1-ene-1,3-diol.
| Compound Name | 1-ethoxypent-1-ene-1,3-diol |
|---|---|
| PubChem CID | 162291132 |
| Molecular Formula | C7H14O3 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | 1-ethoxypent-1-ene-1,3-diol |
| SMILES | CCOC(O)=CC(O)CC |
| InChI | InChI=1S/C7H14O3/c1-3-6(8)5-7(9)10-4-2/h5-6,8-9H,3-4H2,1-2H3 |
| InChIKey | RQWSICCOPXEFSH-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|