C8H10F3NO2 — CID 97136645
(E,3R)-5-ethoxy-5-hydroxy-3-(trifluoromethyl)pent-4-enenitrile (PubChem CID 97136645) has the molecular formula C8H10F3NO2 and a molecular weight of 209.17 g/mol. Its IUPAC name is (E,3R)-5-ethoxy-5-hydroxy-3-(trifluoromethyl)pent-4-enenitrile.
| Compound Name | (E,3R)-5-ethoxy-5-hydroxy-3-(trifluoromethyl)pent-4-enenitrile |
|---|---|
| PubChem CID | 97136645 |
| Molecular Formula | C8H10F3NO2 |
| Molecular Weight | 209.17 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | (E,3R)-5-ethoxy-5-hydroxy-3-(trifluoromethyl)pent-4-enenitrile |
| SMILES | CCO/C(O)=C/[C@@H](CC#N)C(F)(F)F |
| InChI | InChI=1S/C8H10F3NO2/c1-2-14-7(13)5-6(3-4-12)8(9,10)11/h5-6,13H,2-3H2,1H3/b7-5+/t6-/m1/s1 |
| InChIKey | JVUAQKZGURYUMF-LUFONEFESA-N |
| XLogP | 2.51 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.17 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|