C14H15F2NO3 — CID 46177420
ethyl 3-(cyanomethyl)-2,2-difluoro-4-phenoxybutanoate (PubChem CID 46177420) has the molecular formula C14H15F2NO3 and a molecular weight of 283.27 g/mol. Its IUPAC name is ethyl 3-(cyanomethyl)-2,2-difluoro-4-phenoxybutanoate.
| Compound Name | ethyl 3-(cyanomethyl)-2,2-difluoro-4-phenoxybutanoate |
|---|---|
| PubChem CID | 46177420 |
| Molecular Formula | C14H15F2NO3 |
| Molecular Weight | 283.27 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | ethyl 3-(cyanomethyl)-2,2-difluoro-4-phenoxybutanoate |
| SMILES | CCOC(=O)C(F)(F)C(CC#N)COc1ccccc1 |
| InChI | InChI=1S/C14H15F2NO3/c1-2-19-13(18)14(15,16)11(8-9-17)10-20-12-6-4-3-5-7-12/h3-7,11H,2,8,10H2,1H3 |
| InChIKey | BJGFKHQUHLACOD-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.27 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |