About acetaldehyde;2-hydroxybutanal
acetaldehyde;2-hydroxybutanal (PubChem CID 126485500) has the molecular formula C6H12O3
and a molecular weight of 132.16 g/mol. Its IUPAC name is acetaldehyde;2-hydroxybutanal.
Molecular Properties
| Compound Name | acetaldehyde;2-hydroxybutanal |
| PubChem CID | 126485500 |
| Molecular Formula | C6H12O3 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.08 |
| IUPAC Name | acetaldehyde;2-hydroxybutanal |
| SMILES | CC=O.CCC(O)C=O |
| InChI | InChI=1S/C4H8O2.C2H4O/c1-2-4(6)3-5;1-2-3/h3-4,6H,2H2,1H3;2H,1H3 |
| InChIKey | LYXXBBAMBHSARM-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze acetaldehyde;2-hydroxybutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetaldehyde;2-hydroxybutanal?
The IUPAC name of acetaldehyde;2-hydroxybutanal (CID 126485500) is acetaldehyde;2-hydroxybutanal.
What is the SMILES notation for acetaldehyde;2-hydroxybutanal?
The canonical SMILES for acetaldehyde;2-hydroxybutanal is CC=O.CCC(O)C=O.
What is the InChIKey of acetaldehyde;2-hydroxybutanal?
The InChIKey is LYXXBBAMBHSARM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O2.C2H4O/c1-2-4(6)3-5;1-2-3/h3-4,6H,2H2,1H3;2H,1H3.
What are the key properties of acetaldehyde;2-hydroxybutanal?
acetaldehyde;2-hydroxybutanal has a molecular weight of 132.16 g/mol, XLogP of 0.16, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetaldehyde;2-hydroxybutanal is sourced from PubChem (CID 126485500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).