C6H14ClNO2 — CID 158373380
(2-hydroxy-3-oxopropyl)-trimethylazanium chloride (PubChem CID 158373380) has the molecular formula C6H14ClNO2 and a molecular weight of 167.64 g/mol. Its IUPAC name is (2-hydroxy-3-oxopropyl)-trimethylazanium chloride.
| Compound Name | (2-hydroxy-3-oxopropyl)-trimethylazanium chloride |
|---|---|
| PubChem CID | 158373380 |
| Molecular Formula | C6H14ClNO2 |
| Molecular Weight | 167.64 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | (2-hydroxy-3-oxopropyl)-trimethylazanium chloride |
| SMILES | C[N+](C)(C)CC(O)C=O.[Cl-] |
| InChI | InChI=1S/C6H14NO2.ClH/c1-7(2,3)4-6(9)5-8;/h5-6,9H,4H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | MGFJLJLJDQPAMO-UHFFFAOYSA-M |
| XLogP | -3.74 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.64 |
| LogP ≤ 5 | -3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|