About (4-amino-2-hydroxybutyl)-trimethylazanium;chloride;hydrochloride
(4-amino-2-hydroxybutyl)-trimethylazanium;chloride;hydrochloride (PubChem CID 3026354) has the molecular formula C7H20Cl2N2O
and a molecular weight of 219.16 g/mol. Its IUPAC name is (4-amino-2-hydroxybutyl)-trimethylazanium;chloride;hydrochloride.
Molecular Properties
| Compound Name | (4-amino-2-hydroxybutyl)-trimethylazanium;chloride;hydrochloride |
| PubChem CID | 3026354 |
| Molecular Formula | C7H20Cl2N2O |
| Molecular Weight | 219.16 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | (4-amino-2-hydroxybutyl)-trimethylazanium;chloride;hydrochloride |
| SMILES | C[N+](C)(C)CC(O)CCN.Cl.[Cl-] |
| InChI | InChI=1S/C7H19N2O.2ClH/c1-9(2,3)6-7(10)4-5-8;;/h7,10H,4-6,8H2,1-3H3;2*1H/q+1;;/p-1 |
| InChIKey | SFAZPSNUMFZTSR-UHFFFAOYSA-M |
| XLogP | -3.17 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.16 |
| LogP ≤ 5 | -3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (4-amino-2-hydroxybutyl)-trimethylazanium;chloride;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-amino-2-hydroxybutyl)-trimethylazanium;chloride;hydrochloride?
The IUPAC name of (4-amino-2-hydroxybutyl)-trimethylazanium;chloride;hydrochloride (CID 3026354) is (4-amino-2-hydroxybutyl)-trimethylazanium;chloride;hydrochloride.
What is the SMILES notation for (4-amino-2-hydroxybutyl)-trimethylazanium;chloride;hydrochloride?
The canonical SMILES for (4-amino-2-hydroxybutyl)-trimethylazanium;chloride;hydrochloride is C[N+](C)(C)CC(O)CCN.Cl.[Cl-].
What is the InChIKey of (4-amino-2-hydroxybutyl)-trimethylazanium;chloride;hydrochloride?
The InChIKey is SFAZPSNUMFZTSR-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H19N2O.2ClH/c1-9(2,3)6-7(10)4-5-8;;/h7,10H,4-6,8H2,1-3H3;2*1H/q+1;;/p-1.
What are the key properties of (4-amino-2-hydroxybutyl)-trimethylazanium;chloride;hydrochloride?
(4-amino-2-hydroxybutyl)-trimethylazanium;chloride;hydrochloride has a molecular weight of 219.16 g/mol, XLogP of -3.17, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-amino-2-hydroxybutyl)-trimethylazanium;chloride;hydrochloride is sourced from PubChem (CID 3026354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).