About (6-amino-2-hydroxy-3-oxohexyl)-trimethylazanium;chloride;hydrochloride
(6-amino-2-hydroxy-3-oxohexyl)-trimethylazanium;chloride;hydrochloride (PubChem CID 21126986) has the molecular formula C9H22Cl2N2O2
and a molecular weight of 261.19 g/mol. Its IUPAC name is (6-amino-2-hydroxy-3-oxohexyl)-trimethylazanium;chloride;hydrochloride.
Molecular Properties
| Compound Name | (6-amino-2-hydroxy-3-oxohexyl)-trimethylazanium;chloride;hydrochloride |
| PubChem CID | 21126986 |
| Molecular Formula | C9H22Cl2N2O2 |
| Molecular Weight | 261.19 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | (6-amino-2-hydroxy-3-oxohexyl)-trimethylazanium;chloride;hydrochloride |
| SMILES | C[N+](C)(C)CC(O)C(=O)CCCN.Cl.[Cl-] |
| InChI | InChI=1S/C9H21N2O2.2ClH/c1-11(2,3)7-9(13)8(12)5-4-6-10;;/h9,13H,4-7,10H2,1-3H3;2*1H/q+1;;/p-1 |
| InChIKey | IVJLRCFUCWPPMV-UHFFFAOYSA-M |
| XLogP | -3.21 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.19 |
| LogP ≤ 5 | -3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (6-amino-2-hydroxy-3-oxohexyl)-trimethylazanium;chloride;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-amino-2-hydroxy-3-oxohexyl)-trimethylazanium;chloride;hydrochloride?
The IUPAC name of (6-amino-2-hydroxy-3-oxohexyl)-trimethylazanium;chloride;hydrochloride (CID 21126986) is (6-amino-2-hydroxy-3-oxohexyl)-trimethylazanium;chloride;hydrochloride.
What is the SMILES notation for (6-amino-2-hydroxy-3-oxohexyl)-trimethylazanium;chloride;hydrochloride?
The canonical SMILES for (6-amino-2-hydroxy-3-oxohexyl)-trimethylazanium;chloride;hydrochloride is C[N+](C)(C)CC(O)C(=O)CCCN.Cl.[Cl-].
What is the InChIKey of (6-amino-2-hydroxy-3-oxohexyl)-trimethylazanium;chloride;hydrochloride?
The InChIKey is IVJLRCFUCWPPMV-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H21N2O2.2ClH/c1-11(2,3)7-9(13)8(12)5-4-6-10;;/h9,13H,4-7,10H2,1-3H3;2*1H/q+1;;/p-1.
What are the key properties of (6-amino-2-hydroxy-3-oxohexyl)-trimethylazanium;chloride;hydrochloride?
(6-amino-2-hydroxy-3-oxohexyl)-trimethylazanium;chloride;hydrochloride has a molecular weight of 261.19 g/mol, XLogP of -3.21, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6-amino-2-hydroxy-3-oxohexyl)-trimethylazanium;chloride;hydrochloride is sourced from PubChem (CID 21126986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).