C6H16NO2Tb- — CID 153386909
4-aminobutane-1,2-diol;ethane;terbium (PubChem CID 153386909) has the molecular formula C6H16NO2Tb- and a molecular weight of 293.12 g/mol. Its IUPAC name is 4-aminobutane-1,2-diol;ethane;terbium.
| Compound Name | 4-aminobutane-1,2-diol;ethane;terbium |
|---|---|
| PubChem CID | 153386909 |
| Molecular Formula | C6H16NO2Tb- |
| Molecular Weight | 293.12 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 4-aminobutane-1,2-diol;ethane;terbium |
| SMILES | NCCC(O)CO.[CH2-]C.[Tb] |
| InChI | InChI=1S/C4H11NO2.C2H5.Tb/c5-2-1-4(7)3-6;1-2;/h4,6-7H,1-3,5H2;1H2,2H3;/q;-1; |
| InChIKey | GBTUUJFCBOWYLE-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.12 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|