C8H24N2O8S — CID 71422701
bis((2S)-4-aminobutane-1,2-diol);sulfuric acid (PubChem CID 71422701) has the molecular formula C8H24N2O8S and a molecular weight of 308.35 g/mol. Its IUPAC name is bis((2S)-4-aminobutane-1,2-diol);sulfuric acid.
| Compound Name | bis((2S)-4-aminobutane-1,2-diol);sulfuric acid |
|---|---|
| PubChem CID | 71422701 |
| Molecular Formula | C8H24N2O8S |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | bis((2S)-4-aminobutane-1,2-diol);sulfuric acid |
| SMILES | NCC[C@H](O)CO.NCC[C@H](O)CO.O=S(=O)(O)O |
| InChI | InChI=1S/2C4H11NO2.H2O4S/c2*5-2-1-4(7)3-6;1-5(2,3)4/h2*4,6-7H,1-3,5H2;(H2,1,2,3,4)/t2*4-;/m00./s1 |
| InChIKey | OXOCSJTYAZUZSX-SCGRZTRASA-N |
| XLogP | -3.28 |
| TPSA | 207.56 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | -3.28 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|