C6H20N2O10S — CID 173047526
bis(1-aminopropane-1,2,3-triol);sulfuric acid (PubChem CID 173047526) has the molecular formula C6H20N2O10S and a molecular weight of 312.30 g/mol. Its IUPAC name is bis(1-aminopropane-1,2,3-triol);sulfuric acid.
| Compound Name | bis(1-aminopropane-1,2,3-triol);sulfuric acid |
|---|---|
| PubChem CID | 173047526 |
| Molecular Formula | C6H20N2O10S |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | bis(1-aminopropane-1,2,3-triol);sulfuric acid |
| SMILES | NC(O)C(O)CO.NC(O)C(O)CO.O=S(=O)(O)O |
| InChI | InChI=1S/2C3H9NO3.H2O4S/c2*4-3(7)2(6)1-5;1-5(2,3)4/h2*2-3,5-7H,1,4H2;(H2,1,2,3,4) |
| InChIKey | LIVRQXIJERMPQF-UHFFFAOYSA-N |
| XLogP | -5.42 |
| TPSA | 248.02 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | -5.42 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|