C18H11ClN4O3S2 — CID 22525617
(NE)-4-chloro-N-[4-oxo-3-(1H-1,2,4-triazol-5-ylsulfanyl)naphthalen-1-ylidene]benzenesulfonamide (PubChem CID 22525617) has the molecular formula C18H11ClN4O3S2 and a molecular weight of 430.90 g/mol. Its IUPAC name is (NE)-4-chloro-N-[4-oxo-3-(1H-1,2,4-triazol-5-ylsulfanyl)naphthalen-1-ylidene]benzenesulfonamide.
| Compound Name | (NE)-4-chloro-N-[4-oxo-3-(1H-1,2,4-triazol-5-ylsulfanyl)naphthalen-1-ylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 22525617 |
| Molecular Formula | C18H11ClN4O3S2 |
| Molecular Weight | 430.90 g/mol |
| Exact Mass | 430.00 |
| IUPAC Name | (NE)-4-chloro-N-[4-oxo-3-(1H-1,2,4-triazol-5-ylsulfanyl)naphthalen-1-ylidene]benzenesulfonamide |
| SMILES | O=C1C(Sc2ncn[nH]2)=C/C(=N\S(=O)(=O)c2ccc(Cl)cc2)c2ccccc21 |
| InChI | InChI=1S/C18H11ClN4O3S2/c19-11-5-7-12(8-6-11)28(25,26)23-15-9-16(27-18-20-10-21-22-18)17(24)14-4-2-1-3-13(14)15/h1-10H,(H,20,21,22)/b23-15+ |
| InChIKey | WGWYBMRNSNBHIT-HZHRSRAPSA-N |
| XLogP | 3.51 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.90 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|