C19H19ClN2O3S2 — CID 27317882
N-[(5R)-5-butyl-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]-4-chlorobenzenesulfonamide (PubChem CID 27317882) has the molecular formula C19H19ClN2O3S2 and a molecular weight of 422.96 g/mol. Its IUPAC name is N-[(5R)-5-butyl-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]-4-chlorobenzenesulfonamide.
| Compound Name | N-[(5R)-5-butyl-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]-4-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 27317882 |
| Molecular Formula | C19H19ClN2O3S2 |
| Molecular Weight | 422.96 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | N-[(5R)-5-butyl-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]-4-chlorobenzenesulfonamide |
| SMILES | CCCC[C@H]1SC(=NS(=O)(=O)c2ccc(Cl)cc2)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C19H19ClN2O3S2/c1-2-3-9-17-18(23)22(15-7-5-4-6-8-15)19(26-17)21-27(24,25)16-12-10-14(20)11-13-16/h4-8,10-13,17H,2-3,9H2,1H3/t17-/m1/s1 |
| InChIKey | BIXPSTMFUQVXIM-QGZVFWFLSA-N |
| XLogP | 4.72 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.96 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|