C23H18ClN3O4S2 — CID 4260826
2-[2-(benzenesulfonylimino)-4-oxo-3-phenyl-1,3-thiazolidin-5-yl]-N-(4-chlorophenyl)acetamide (PubChem CID 4260826) has the molecular formula C23H18ClN3O4S2 and a molecular weight of 500.00 g/mol. Its IUPAC name is 2-[2-(benzenesulfonylimino)-4-oxo-3-phenyl-1,3-thiazolidin-5-yl]-N-(4-chlorophenyl)acetamide.
| Compound Name | 2-[2-(benzenesulfonylimino)-4-oxo-3-phenyl-1,3-thiazolidin-5-yl]-N-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 4260826 |
| Molecular Formula | C23H18ClN3O4S2 |
| Molecular Weight | 500.00 g/mol |
| Exact Mass | 499.04 |
| IUPAC Name | 2-[2-(benzenesulfonylimino)-4-oxo-3-phenyl-1,3-thiazolidin-5-yl]-N-(4-chlorophenyl)acetamide |
| SMILES | O=C(CC1SC(=NS(=O)(=O)c2ccccc2)N(c2ccccc2)C1=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H18ClN3O4S2/c24-16-11-13-17(14-12-16)25-21(28)15-20-22(29)27(18-7-3-1-4-8-18)23(32-20)26-33(30,31)19-9-5-2-6-10-19/h1-14,20H,15H2,(H,25,28) |
| InChIKey | FFCXSZXBVDEEOP-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.00 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|