C23H20Cl2N4O2S — CID 15603838
N-[(4S)-5-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazol-2-yl]-N'-(4-chlorophenyl)sulfonyl-N-methylmethanimidamide (PubChem CID 15603838) has the molecular formula C23H20Cl2N4O2S and a molecular weight of 487.41 g/mol. Its IUPAC name is N-[(4S)-5-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazol-2-yl]-N'-(4-chlorophenyl)sulfonyl-N-methylmethanimidamide.
| Compound Name | N-[(4S)-5-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazol-2-yl]-N'-(4-chlorophenyl)sulfonyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 15603838 |
| Molecular Formula | C23H20Cl2N4O2S |
| Molecular Weight | 487.41 g/mol |
| Exact Mass | 486.07 |
| IUPAC Name | N-[(4S)-5-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazol-2-yl]-N'-(4-chlorophenyl)sulfonyl-N-methylmethanimidamide |
| SMILES | CN(/C=N/S(=O)(=O)c1ccc(Cl)cc1)N1C[C@H](c2ccccc2)C(c2ccc(Cl)cc2)=N1 |
| InChI | InChI=1S/C23H20Cl2N4O2S/c1-28(16-26-32(30,31)21-13-11-20(25)12-14-21)29-15-22(17-5-3-2-4-6-17)23(27-29)18-7-9-19(24)10-8-18/h2-14,16,22H,15H2,1H3/b26-16+/t22-/m1/s1 |
| InChIKey | LDTNTEBXDKRMBD-XDEFOSFOSA-N |
| XLogP | 5.06 |
| TPSA | 65.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.41 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|