C24H21NO3S — CID 139095496
(NZ)-4-methyl-N-[(2'S,4R)-2'-phenylspiro[1H-isochromene-4,1'-cyclopropane]-3-ylidene]benzenesulfonamide (PubChem CID 139095496) has the molecular formula C24H21NO3S and a molecular weight of 403.50 g/mol. Its IUPAC name is (NZ)-4-methyl-N-[(2'S,4R)-2'-phenylspiro[1H-isochromene-4,1'-cyclopropane]-3-ylidene]benzenesulfonamide.
| Compound Name | (NZ)-4-methyl-N-[(2'S,4R)-2'-phenylspiro[1H-isochromene-4,1'-cyclopropane]-3-ylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 139095496 |
| Molecular Formula | C24H21NO3S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | (NZ)-4-methyl-N-[(2'S,4R)-2'-phenylspiro[1H-isochromene-4,1'-cyclopropane]-3-ylidene]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)/N=C2\OCc3ccccc3[C@]23C[C@H]3c2ccccc2)cc1 |
| InChI | InChI=1S/C24H21NO3S/c1-17-11-13-20(14-12-17)29(26,27)25-23-24(15-22(24)18-7-3-2-4-8-18)21-10-6-5-9-19(21)16-28-23/h2-14,22H,15-16H2,1H3/b25-23-/t22-,24-/m0/s1 |
| InChIKey | LFEYIKFFYVMSEL-ROBFFYTESA-N |
| XLogP | 4.74 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|