C15H20N2O3S — CID 139038854
(NZ)-N-[(7aR)-6,6-dimethyl-1,5,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-3-ylidene]-4-methylbenzenesulfonamide (PubChem CID 139038854) has the molecular formula C15H20N2O3S and a molecular weight of 308.40 g/mol. Its IUPAC name is (NZ)-N-[(7aR)-6,6-dimethyl-1,5,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-3-ylidene]-4-methylbenzenesulfonamide.
| Compound Name | (NZ)-N-[(7aR)-6,6-dimethyl-1,5,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-3-ylidene]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 139038854 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | (NZ)-N-[(7aR)-6,6-dimethyl-1,5,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-3-ylidene]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)/N=C2\OC[C@H]3CC(C)(C)CN23)cc1 |
| InChI | InChI=1S/C15H20N2O3S/c1-11-4-6-13(7-5-11)21(18,19)16-14-17-10-15(2,3)8-12(17)9-20-14/h4-7,12H,8-10H2,1-3H3/b16-14-/t12-/m1/s1 |
| InChIKey | ZZSKNECDNIHRRV-HRZQKCLFSA-N |
| XLogP | 2.17 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|