C21H29Cl2NO3S2 — CID 102398654
(4R,5R)-4-butyl-3,3-dichloro-5-cyclohexylsulfanyl-1-(4-methylphenyl)sulfonylpyrrolidin-2-one (PubChem CID 102398654) has the molecular formula C21H29Cl2NO3S2 and a molecular weight of 478.51 g/mol. Its IUPAC name is (4R,5R)-4-butyl-3,3-dichloro-5-cyclohexylsulfanyl-1-(4-methylphenyl)sulfonylpyrrolidin-2-one.
| Compound Name | (4R,5R)-4-butyl-3,3-dichloro-5-cyclohexylsulfanyl-1-(4-methylphenyl)sulfonylpyrrolidin-2-one |
|---|---|
| PubChem CID | 102398654 |
| Molecular Formula | C21H29Cl2NO3S2 |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | (4R,5R)-4-butyl-3,3-dichloro-5-cyclohexylsulfanyl-1-(4-methylphenyl)sulfonylpyrrolidin-2-one |
| SMILES | CCCC[C@@H]1[C@@H](SC2CCCCC2)N(S(=O)(=O)c2ccc(C)cc2)C(=O)C1(Cl)Cl |
| InChI | InChI=1S/C21H29Cl2NO3S2/c1-3-4-10-18-19(28-16-8-6-5-7-9-16)24(20(25)21(18,22)23)29(26,27)17-13-11-15(2)12-14-17/h11-14,16,18-19H,3-10H2,1-2H3/t18-,19-/m1/s1 |
| InChIKey | YTHJNPIQBUPMNG-RTBURBONSA-N |
| XLogP | 5.90 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|