C32H38N2O4S — CID 133190802
6-tert-butyl-4-(4-methylphenyl)sulfonyl-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 133190802) has the molecular formula C32H38N2O4S and a molecular weight of 546.73 g/mol. Its IUPAC name is 6-tert-butyl-4-(4-methylphenyl)sulfonyl-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | 6-tert-butyl-4-(4-methylphenyl)sulfonyl-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 133190802 |
| Molecular Formula | C32H38N2O4S |
| Molecular Weight | 546.73 g/mol |
| Exact Mass | 546.26 |
| IUPAC Name | 6-tert-butyl-4-(4-methylphenyl)sulfonyl-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(C(=O)NC(C)c3ccc4c(c3)CCCC4)Oc3ccc(C(C)(C)C)cc32)cc1 |
| InChI | InChI=1S/C32H38N2O4S/c1-21-10-15-27(16-11-21)39(36,37)34-20-30(38-29-17-14-26(19-28(29)34)32(3,4)5)31(35)33-22(2)24-13-12-23-8-6-7-9-25(23)18-24/h10-19,22,30H,6-9,20H2,1-5H3,(H,33,35) |
| InChIKey | LSDIQFUDNKYHMU-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.73 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |