C22H25ClN2O4S — CID 133190792
6-chloro-4-methylsulfonyl-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 133190792) has the molecular formula C22H25ClN2O4S and a molecular weight of 448.97 g/mol. Its IUPAC name is 6-chloro-4-methylsulfonyl-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | 6-chloro-4-methylsulfonyl-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 133190792 |
| Molecular Formula | C22H25ClN2O4S |
| Molecular Weight | 448.97 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 6-chloro-4-methylsulfonyl-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | CC(NC(=O)C1CN(S(C)(=O)=O)c2cc(Cl)ccc2O1)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C22H25ClN2O4S/c1-14(16-8-7-15-5-3-4-6-17(15)11-16)24-22(26)21-13-25(30(2,27)28)19-12-18(23)9-10-20(19)29-21/h7-12,14,21H,3-6,13H2,1-2H3,(H,24,26) |
| InChIKey | NUWUHYBWBIWFPK-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.97 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |