C23H27ClN2O4S — CID 125080105
(2R)-6-chloro-4-methylsulfonyl-N-[(1S)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 125080105) has the molecular formula C23H27ClN2O4S and a molecular weight of 463.00 g/mol. Its IUPAC name is (2R)-6-chloro-4-methylsulfonyl-N-[(1S)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | (2R)-6-chloro-4-methylsulfonyl-N-[(1S)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 125080105 |
| Molecular Formula | C23H27ClN2O4S |
| Molecular Weight | 463.00 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | (2R)-6-chloro-4-methylsulfonyl-N-[(1S)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | CC[C@H](NC(=O)[C@H]1CN(S(C)(=O)=O)c2cc(Cl)ccc2O1)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C23H27ClN2O4S/c1-3-19(17-9-8-15-6-4-5-7-16(15)12-17)25-23(27)22-14-26(31(2,28)29)20-13-18(24)10-11-21(20)30-22/h8-13,19,22H,3-7,14H2,1-2H3,(H,25,27)/t19-,22+/m0/s1 |
| InChIKey | GDNONZYYCMYBMP-SIKLNZKXSA-N |
| XLogP | 4.01 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.00 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |