C28H29ClN2O4S — CID 125081438
(2R)-4-(4-chlorophenyl)sulfonyl-N-[(1S)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 125081438) has the molecular formula C28H29ClN2O4S and a molecular weight of 525.07 g/mol. Its IUPAC name is (2R)-4-(4-chlorophenyl)sulfonyl-N-[(1S)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | (2R)-4-(4-chlorophenyl)sulfonyl-N-[(1S)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 125081438 |
| Molecular Formula | C28H29ClN2O4S |
| Molecular Weight | 525.07 g/mol |
| Exact Mass | 524.15 |
| IUPAC Name | (2R)-4-(4-chlorophenyl)sulfonyl-N-[(1S)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | CC[C@H](NC(=O)[C@H]1CN(S(=O)(=O)c2ccc(Cl)cc2)c2ccccc2O1)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C28H29ClN2O4S/c1-2-24(21-12-11-19-7-3-4-8-20(19)17-21)30-28(32)27-18-31(25-9-5-6-10-26(25)35-27)36(33,34)23-15-13-22(29)14-16-23/h5-6,9-17,24,27H,2-4,7-8,18H2,1H3,(H,30,32)/t24-,27+/m0/s1 |
| InChIKey | JRMGAFMEMHTNOL-RPLLCQBOSA-N |
| XLogP | 5.44 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.07 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |