C29H31ClN2O5S — CID 133191594
6-chloro-4-(4-methoxyphenyl)sulfonyl-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 133191594) has the molecular formula C29H31ClN2O5S and a molecular weight of 555.10 g/mol. Its IUPAC name is 6-chloro-4-(4-methoxyphenyl)sulfonyl-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | 6-chloro-4-(4-methoxyphenyl)sulfonyl-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 133191594 |
| Molecular Formula | C29H31ClN2O5S |
| Molecular Weight | 555.10 g/mol |
| Exact Mass | 554.16 |
| IUPAC Name | 6-chloro-4-(4-methoxyphenyl)sulfonyl-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | CCC(NC(=O)C1CN(S(=O)(=O)c2ccc(OC)cc2)c2cc(Cl)ccc2O1)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C29H31ClN2O5S/c1-3-25(21-9-8-19-6-4-5-7-20(19)16-21)31-29(33)28-18-32(26-17-22(30)10-15-27(26)37-28)38(34,35)24-13-11-23(36-2)12-14-24/h8-17,25,28H,3-7,18H2,1-2H3,(H,31,33) |
| InChIKey | JATJSGXVJCQSRR-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.10 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |