C27H25N3O4S3 — CID 90264324
(1S,4S,7S,9S)-16-(benzenesulfonyl)-5-methyl-9-(4-methylphenyl)-4,7-bis(sulfanyl)-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-triene-3,6-dione (PubChem CID 90264324) has the molecular formula C27H25N3O4S3 and a molecular weight of 551.72 g/mol. Its IUPAC name is (1S,4S,7S,9S)-16-(benzenesulfonyl)-5-methyl-9-(4-methylphenyl)-4,7-bis(sulfanyl)-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-triene-3,6-dione.
| Compound Name | (1S,4S,7S,9S)-16-(benzenesulfonyl)-5-methyl-9-(4-methylphenyl)-4,7-bis(sulfanyl)-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-triene-3,6-dione |
|---|---|
| PubChem CID | 90264324 |
| Molecular Formula | C27H25N3O4S3 |
| Molecular Weight | 551.72 g/mol |
| Exact Mass | 551.10 |
| IUPAC Name | (1S,4S,7S,9S)-16-(benzenesulfonyl)-5-methyl-9-(4-methylphenyl)-4,7-bis(sulfanyl)-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-triene-3,6-dione |
| SMILES | Cc1ccc([C@]23C[C@]4(S)C(=O)N(C)[C@@H](S)C(=O)N4[C@H]2N(S(=O)(=O)c2ccccc2)c2ccccc23)cc1 |
| InChI | InChI=1S/C27H25N3O4S3/c1-17-12-14-18(15-13-17)26-16-27(36)25(32)28(2)23(35)22(31)29(27)24(26)30(21-11-7-6-10-20(21)26)37(33,34)19-8-4-3-5-9-19/h3-15,23-24,35-36H,16H2,1-2H3/t23-,24-,26-,27-/m0/s1 |
| InChIKey | LSPKVNRHHUUBLK-DROSFRCNSA-N |
| XLogP | 3.40 |
| TPSA | 78.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.72 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|