C30H28N6O4S3 — CID 158503300
(1S,3S,11S,14S)-18-(4-azidobutyl)-10-(benzenesulfonyl)-3-(4-methylphenyl)-15,16-dithia-10,12,18-triazapentacyclo[12.2.2.01,12.03,11.04,9]octadeca-4,6,8-triene-13,17-dione (PubChem CID 158503300) has the molecular formula C30H28N6O4S3 and a molecular weight of 632.79 g/mol. Its IUPAC name is (1S,3S,11S,14S)-18-(4-azidobutyl)-10-(benzenesulfonyl)-3-(4-methylphenyl)-15,16-dithia-10,12,18-triazapentacyclo[12.2.2.01,12.03,11.04,9]octadeca-4,6,8-triene-13,17-dione.
| Compound Name | (1S,3S,11S,14S)-18-(4-azidobutyl)-10-(benzenesulfonyl)-3-(4-methylphenyl)-15,16-dithia-10,12,18-triazapentacyclo[12.2.2.01,12.03,11.04,9]octadeca-4,6,8-triene-13,17-dione |
|---|---|
| PubChem CID | 158503300 |
| Molecular Formula | C30H28N6O4S3 |
| Molecular Weight | 632.79 g/mol |
| Exact Mass | 632.13 |
| IUPAC Name | (1S,3S,11S,14S)-18-(4-azidobutyl)-10-(benzenesulfonyl)-3-(4-methylphenyl)-15,16-dithia-10,12,18-triazapentacyclo[12.2.2.01,12.03,11.04,9]octadeca-4,6,8-triene-13,17-dione |
| SMILES | Cc1ccc([C@]23C[C@@]45SS[C@@H](C(=O)N4[C@H]2N(S(=O)(=O)c2ccccc2)c2ccccc23)N(CCCCN=[N+]=[N-])C5=O)cc1 |
| InChI | InChI=1S/C30H28N6O4S3/c1-20-13-15-21(16-14-20)29-19-30-28(38)34(18-8-7-17-32-33-31)26(41-42-30)25(37)35(30)27(29)36(24-12-6-5-11-23(24)29)43(39,40)22-9-3-2-4-10-22/h2-6,9-16,26-27H,7-8,17-19H2,1H3/t26-,27-,29-,30-/m0/s1 |
| InChIKey | NFBHUICUGQLNGU-ZHTHUIBPSA-N |
| XLogP | 5.40 |
| TPSA | 126.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.79 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|