C29H29N3O6S — CID 155647884
(1S,7S,9S)-16-(benzenesulfonyl)-9-[4-(3-hydroxypropoxy)phenyl]-5-methyl-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-triene-3,6-dione (PubChem CID 155647884) has the molecular formula C29H29N3O6S and a molecular weight of 547.63 g/mol. Its IUPAC name is (1S,7S,9S)-16-(benzenesulfonyl)-9-[4-(3-hydroxypropoxy)phenyl]-5-methyl-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-triene-3,6-dione.
| Compound Name | (1S,7S,9S)-16-(benzenesulfonyl)-9-[4-(3-hydroxypropoxy)phenyl]-5-methyl-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-triene-3,6-dione |
|---|---|
| PubChem CID | 155647884 |
| Molecular Formula | C29H29N3O6S |
| Molecular Weight | 547.63 g/mol |
| Exact Mass | 547.18 |
| IUPAC Name | (1S,7S,9S)-16-(benzenesulfonyl)-9-[4-(3-hydroxypropoxy)phenyl]-5-methyl-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-triene-3,6-dione |
| SMILES | CN1CC(=O)N2[C@@H](C[C@]3(c4ccc(OCCCO)cc4)c4ccccc4N(S(=O)(=O)c4ccccc4)[C@H]23)C1=O |
| InChI | InChI=1S/C29H29N3O6S/c1-30-19-26(34)31-25(27(30)35)18-29(20-12-14-21(15-13-20)38-17-7-16-33)23-10-5-6-11-24(23)32(28(29)31)39(36,37)22-8-3-2-4-9-22/h2-6,8-15,25,28,33H,7,16-19H2,1H3/t25-,28-,29-/m0/s1 |
| InChIKey | SHOIDQPILFTAAY-FMYROPPKSA-N |
| XLogP | 2.34 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.63 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|