C20H18FN3O4S3 — CID 90264322
(1S,4S,7S,9S)-16-(benzenesulfonyl)-9-fluoro-5-methyl-4,7-bis(sulfanyl)-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-triene-3,6-dione (PubChem CID 90264322) has the molecular formula C20H18FN3O4S3 and a molecular weight of 479.58 g/mol. Its IUPAC name is (1S,4S,7S,9S)-16-(benzenesulfonyl)-9-fluoro-5-methyl-4,7-bis(sulfanyl)-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-triene-3,6-dione.
| Compound Name | (1S,4S,7S,9S)-16-(benzenesulfonyl)-9-fluoro-5-methyl-4,7-bis(sulfanyl)-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-triene-3,6-dione |
|---|---|
| PubChem CID | 90264322 |
| Molecular Formula | C20H18FN3O4S3 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.04 |
| IUPAC Name | (1S,4S,7S,9S)-16-(benzenesulfonyl)-9-fluoro-5-methyl-4,7-bis(sulfanyl)-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-triene-3,6-dione |
| SMILES | CN1C(=O)[C@@]2(S)C[C@]3(F)c4ccccc4N(S(=O)(=O)c4ccccc4)[C@@H]3N2C(=O)[C@@H]1S |
| InChI | InChI=1S/C20H18FN3O4S3/c1-22-16(29)15(25)23-17-19(21,11-20(23,30)18(22)26)13-9-5-6-10-14(13)24(17)31(27,28)12-7-3-2-4-8-12/h2-10,16-17,29-30H,11H2,1H3/t16-,17-,19-,20-/m0/s1 |
| InChIKey | MQIUSNTYPSTVJY-ZULIPRJHSA-N |
| XLogP | 1.97 |
| TPSA | 78.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|