C35H36N4O6S — CID 161488366
tert-butyl 3-[(1S,4S,7R,9S)-16-(benzenesulfonyl)-4,5,7-trimethyl-3,6-dioxo-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-trien-9-yl]indole-1-carboxylate (PubChem CID 161488366) has the molecular formula C35H36N4O6S and a molecular weight of 640.76 g/mol. Its IUPAC name is tert-butyl 3-[(1S,4S,7R,9S)-16-(benzenesulfonyl)-4,5,7-trimethyl-3,6-dioxo-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-trien-9-yl]indole-1-carboxylate.
| Compound Name | tert-butyl 3-[(1S,4S,7R,9S)-16-(benzenesulfonyl)-4,5,7-trimethyl-3,6-dioxo-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-trien-9-yl]indole-1-carboxylate |
|---|---|
| PubChem CID | 161488366 |
| Molecular Formula | C35H36N4O6S |
| Molecular Weight | 640.76 g/mol |
| Exact Mass | 640.24 |
| IUPAC Name | tert-butyl 3-[(1S,4S,7R,9S)-16-(benzenesulfonyl)-4,5,7-trimethyl-3,6-dioxo-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-trien-9-yl]indole-1-carboxylate |
| SMILES | C[C@H]1C(=O)N2[C@H]3N(S(=O)(=O)c4ccccc4)c4ccccc4[C@@]3(c3cn(C(=O)OC(C)(C)C)c4ccccc34)C[C@]2(C)C(=O)N1C |
| InChI | InChI=1S/C35H36N4O6S/c1-22-29(40)38-30-35(21-34(38,5)31(41)36(22)6,26-20-37(32(42)45-33(2,3)4)27-18-12-10-16-24(26)27)25-17-11-13-19-28(25)39(30)46(43,44)23-14-8-7-9-15-23/h7-20,22,30H,21H2,1-6H3/t22-,30-,34+,35+/m0/s1 |
| InChIKey | RWZQTPVYNPTDPN-RIPKRNFSSA-N |
| XLogP | 5.10 |
| TPSA | 109.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.76 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |