C24H22N4O4S3 — CID 90266902
(1S,4S,7S,9S)-16-(benzenesulfonyl)-5-methyl-9-(1H-pyrrol-3-yl)-4,7-bis(sulfanyl)-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-triene-3,6-dione (PubChem CID 90266902) has the molecular formula C24H22N4O4S3 and a molecular weight of 526.67 g/mol. Its IUPAC name is (1S,4S,7S,9S)-16-(benzenesulfonyl)-5-methyl-9-(1H-pyrrol-3-yl)-4,7-bis(sulfanyl)-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-triene-3,6-dione.
| Compound Name | (1S,4S,7S,9S)-16-(benzenesulfonyl)-5-methyl-9-(1H-pyrrol-3-yl)-4,7-bis(sulfanyl)-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-triene-3,6-dione |
|---|---|
| PubChem CID | 90266902 |
| Molecular Formula | C24H22N4O4S3 |
| Molecular Weight | 526.67 g/mol |
| Exact Mass | 526.08 |
| IUPAC Name | (1S,4S,7S,9S)-16-(benzenesulfonyl)-5-methyl-9-(1H-pyrrol-3-yl)-4,7-bis(sulfanyl)-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-triene-3,6-dione |
| SMILES | CN1C(=O)[C@@]2(S)C[C@]3(c4cc[nH]c4)c4ccccc4N(S(=O)(=O)c4ccccc4)[C@@H]3N2C(=O)[C@@H]1S |
| InChI | InChI=1S/C24H22N4O4S3/c1-26-20(33)19(29)27-21-23(15-11-12-25-13-15,14-24(27,34)22(26)30)17-9-5-6-10-18(17)28(21)35(31,32)16-7-3-2-4-8-16/h2-13,20-21,25,33-34H,14H2,1H3/t20-,21-,23-,24-/m0/s1 |
| InChIKey | RZHQTQHQPUFGJL-WMIMKTLMSA-N |
| XLogP | 2.42 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.67 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|