C19H20N2O3S — CID 95716062
(3R)-1'-(benzenesulfonyl)-1-methylspiro[indole-3,3'-piperidine]-2-one (PubChem CID 95716062) has the molecular formula C19H20N2O3S and a molecular weight of 356.45 g/mol. Its IUPAC name is (3R)-1'-(benzenesulfonyl)-1-methylspiro[indole-3,3'-piperidine]-2-one.
| Compound Name | (3R)-1'-(benzenesulfonyl)-1-methylspiro[indole-3,3'-piperidine]-2-one |
|---|---|
| PubChem CID | 95716062 |
| Molecular Formula | C19H20N2O3S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | (3R)-1'-(benzenesulfonyl)-1-methylspiro[indole-3,3'-piperidine]-2-one |
| SMILES | CN1C(=O)[C@]2(CCCN(S(=O)(=O)c3ccccc3)C2)c2ccccc21 |
| InChI | InChI=1S/C19H20N2O3S/c1-20-17-11-6-5-10-16(17)19(18(20)22)12-7-13-21(14-19)25(23,24)15-8-3-2-4-9-15/h2-6,8-11H,7,12-14H2,1H3/t19-/m0/s1 |
| InChIKey | WYWDNRUGIVESCS-IBGZPJMESA-N |
| XLogP | 2.39 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |