About (3S)-1'-(4-chlorophenyl)sulfonyl-1-methylspiro[indole-3,3'-pyrrolidine]-2-one
(3S)-1'-(4-chlorophenyl)sulfonyl-1-methylspiro[indole-3,3'-pyrrolidine]-2-one (PubChem CID 95103986) has the molecular formula C18H17ClN2O3S
and a molecular weight of 376.87 g/mol. Its IUPAC name is (3S)-1'-(4-chlorophenyl)sulfonyl-1-methylspiro[indole-3,3'-pyrrolidine]-2-one.
Molecular Properties
| Compound Name | (3S)-1'-(4-chlorophenyl)sulfonyl-1-methylspiro[indole-3,3'-pyrrolidine]-2-one |
| PubChem CID | 95103986 |
| Molecular Formula | C18H17ClN2O3S |
| Molecular Weight | 376.87 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | (3S)-1'-(4-chlorophenyl)sulfonyl-1-methylspiro[indole-3,3'-pyrrolidine]-2-one |
| SMILES | CN1C(=O)[C@@]2(CCN(S(=O)(=O)c3ccc(Cl)cc3)C2)c2ccccc21 |
| InChI | InChI=1S/C18H17ClN2O3S/c1-20-16-5-3-2-4-15(16)18(17(20)22)10-11-21(12-18)25(23,24)14-8-6-13(19)7-9-14/h2-9H,10-12H2,1H3/t18-/m1/s1 |
| InChIKey | PDXGXOSDLOSBHA-GOSISDBHSA-N |
| XLogP | 2.65 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.87 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-1'-(4-chlorophenyl)sulfonyl-1-methylspiro[indole-3,3'-pyrrolidine]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1'-(4-chlorophenyl)sulfonyl-1-methylspiro[indole-3,3'-pyrrolidine]-2-one?
The IUPAC name of (3S)-1'-(4-chlorophenyl)sulfonyl-1-methylspiro[indole-3,3'-pyrrolidine]-2-one (CID 95103986) is (3S)-1'-(4-chlorophenyl)sulfonyl-1-methylspiro[indole-3,3'-pyrrolidine]-2-one.
What is the SMILES notation for (3S)-1'-(4-chlorophenyl)sulfonyl-1-methylspiro[indole-3,3'-pyrrolidine]-2-one?
The canonical SMILES for (3S)-1'-(4-chlorophenyl)sulfonyl-1-methylspiro[indole-3,3'-pyrrolidine]-2-one is CN1C(=O)[C@@]2(CCN(S(=O)(=O)c3ccc(Cl)cc3)C2)c2ccccc21.
What is the InChIKey of (3S)-1'-(4-chlorophenyl)sulfonyl-1-methylspiro[indole-3,3'-pyrrolidine]-2-one?
The InChIKey is PDXGXOSDLOSBHA-GOSISDBHSA-N. The full InChI is InChI=1S/C18H17ClN2O3S/c1-20-16-5-3-2-4-15(16)18(17(20)22)10-11-21(12-18)25(23,24)14-8-6-13(19)7-9-14/h2-9H,10-12H2,1H3/t18-/m1/s1.
What are the key properties of (3S)-1'-(4-chlorophenyl)sulfonyl-1-methylspiro[indole-3,3'-pyrrolidine]-2-one?
(3S)-1'-(4-chlorophenyl)sulfonyl-1-methylspiro[indole-3,3'-pyrrolidine]-2-one has a molecular weight of 376.87 g/mol, XLogP of 2.65, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1'-(4-chlorophenyl)sulfonyl-1-methylspiro[indole-3,3'-pyrrolidine]-2-one is sourced from PubChem (CID 95103986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).