C29H35N3O4S2 — CID 18323613
1-benzyl-5-methylidene-3,7-bis-(4-methylphenyl)sulfonyl-1,3,7-triazecane (PubChem CID 18323613) has the molecular formula C29H35N3O4S2 and a molecular weight of 553.75 g/mol. Its IUPAC name is 1-benzyl-5-methylidene-3,7-bis-(4-methylphenyl)sulfonyl-1,3,7-triazecane.
| Compound Name | 1-benzyl-5-methylidene-3,7-bis-(4-methylphenyl)sulfonyl-1,3,7-triazecane |
|---|---|
| PubChem CID | 18323613 |
| Molecular Formula | C29H35N3O4S2 |
| Molecular Weight | 553.75 g/mol |
| Exact Mass | 553.21 |
| IUPAC Name | 1-benzyl-5-methylidene-3,7-bis-(4-methylphenyl)sulfonyl-1,3,7-triazecane |
| SMILES | C=C1CN(S(=O)(=O)c2ccc(C)cc2)CCCN(Cc2ccccc2)CN(S(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C29H35N3O4S2/c1-24-10-14-28(15-11-24)37(33,34)31-19-7-18-30(22-27-8-5-4-6-9-27)23-32(21-26(3)20-31)38(35,36)29-16-12-25(2)13-17-29/h4-6,8-17H,3,7,18-23H2,1-2H3 |
| InChIKey | FQRVUHNUIAEISZ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.75 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|