C27H37N3O5S2 — CID 11663956
1-[7-methylidene-5,9-bis-(4-methylphenyl)sulfonyl-1,5,9-triazacyclododec-1-yl]propan-1-one (PubChem CID 11663956) has the molecular formula C27H37N3O5S2 and a molecular weight of 547.74 g/mol. Its IUPAC name is 1-[7-methylidene-5,9-bis-(4-methylphenyl)sulfonyl-1,5,9-triazacyclododec-1-yl]propan-1-one.
| Compound Name | 1-[7-methylidene-5,9-bis-(4-methylphenyl)sulfonyl-1,5,9-triazacyclododec-1-yl]propan-1-one |
|---|---|
| PubChem CID | 11663956 |
| Molecular Formula | C27H37N3O5S2 |
| Molecular Weight | 547.74 g/mol |
| Exact Mass | 547.22 |
| IUPAC Name | 1-[7-methylidene-5,9-bis-(4-methylphenyl)sulfonyl-1,5,9-triazacyclododec-1-yl]propan-1-one |
| SMILES | C=C1CN(S(=O)(=O)c2ccc(C)cc2)CCCN(C(=O)CC)CCCN(S(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C27H37N3O5S2/c1-5-27(31)28-16-6-18-29(36(32,33)25-12-8-22(2)9-13-25)20-24(4)21-30(19-7-17-28)37(34,35)26-14-10-23(3)11-15-26/h8-15H,4-7,16-21H2,1-3H3 |
| InChIKey | SVNXIDMFEROXJB-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 95.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.74 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|