C22H25NO2S — CID 101441669
3,5-dimethyl-6-(4-methylphenyl)sulfonyl-1-phenyl-6-azabicyclo[3.2.1]oct-3-ene (PubChem CID 101441669) has the molecular formula C22H25NO2S and a molecular weight of 367.51 g/mol. Its IUPAC name is 3,5-dimethyl-6-(4-methylphenyl)sulfonyl-1-phenyl-6-azabicyclo[3.2.1]oct-3-ene.
| Compound Name | 3,5-dimethyl-6-(4-methylphenyl)sulfonyl-1-phenyl-6-azabicyclo[3.2.1]oct-3-ene |
|---|---|
| PubChem CID | 101441669 |
| Molecular Formula | C22H25NO2S |
| Molecular Weight | 367.51 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 3,5-dimethyl-6-(4-methylphenyl)sulfonyl-1-phenyl-6-azabicyclo[3.2.1]oct-3-ene |
| SMILES | CC1=CC2(C)CC(c3ccccc3)(C1)CN2S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H25NO2S/c1-17-9-11-20(12-10-17)26(24,25)23-16-22(19-7-5-4-6-8-19)14-18(2)13-21(23,3)15-22/h4-13H,14-16H2,1-3H3 |
| InChIKey | XSQIBMWUOFNBHH-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.51 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|