C19H19NO2S — CID 15544069
4-methylidene-1'-(4-methylphenyl)sulfonylspiro[1,2-dihydronaphthalene-3,2'-aziridine] (PubChem CID 15544069) has the molecular formula C19H19NO2S and a molecular weight of 325.43 g/mol. Its IUPAC name is 4-methylidene-1'-(4-methylphenyl)sulfonylspiro[1,2-dihydronaphthalene-3,2'-aziridine].
| Compound Name | 4-methylidene-1'-(4-methylphenyl)sulfonylspiro[1,2-dihydronaphthalene-3,2'-aziridine] |
|---|---|
| PubChem CID | 15544069 |
| Molecular Formula | C19H19NO2S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 4-methylidene-1'-(4-methylphenyl)sulfonylspiro[1,2-dihydronaphthalene-3,2'-aziridine] |
| SMILES | C=C1c2ccccc2CCC12CN2S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H19NO2S/c1-14-7-9-17(10-8-14)23(21,22)20-13-19(20)12-11-16-5-3-4-6-18(16)15(19)2/h3-10H,2,11-13H2,1H3 |
| InChIKey | XCIHJWJWYXCGFX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 37.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|