C17H16F3NO2S — CID 101256655
(2R)-2-benzyl-1-(4-methylphenyl)sulfonyl-2-(trifluoromethyl)aziridine (PubChem CID 101256655) has the molecular formula C17H16F3NO2S and a molecular weight of 355.38 g/mol. Its IUPAC name is (2R)-2-benzyl-1-(4-methylphenyl)sulfonyl-2-(trifluoromethyl)aziridine.
| Compound Name | (2R)-2-benzyl-1-(4-methylphenyl)sulfonyl-2-(trifluoromethyl)aziridine |
|---|---|
| PubChem CID | 101256655 |
| Molecular Formula | C17H16F3NO2S |
| Molecular Weight | 355.38 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | (2R)-2-benzyl-1-(4-methylphenyl)sulfonyl-2-(trifluoromethyl)aziridine |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@]2(Cc2ccccc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H16F3NO2S/c1-13-7-9-15(10-8-13)24(22,23)21-12-16(21,17(18,19)20)11-14-5-3-2-4-6-14/h2-10H,11-12H2,1H3/t16-,21?/m1/s1 |
| InChIKey | DLPWKFVGFBCHGX-UJONTBEJSA-N |
| XLogP | 3.54 |
| TPSA | 37.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.38 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|