C23H29NO3S — CID 171048440
1-[4-benzyl-1-(4-methylphenyl)sulfonylpiperidin-4-yl]but-3-en-1-ol (PubChem CID 171048440) has the molecular formula C23H29NO3S and a molecular weight of 399.56 g/mol. Its IUPAC name is 1-[4-benzyl-1-(4-methylphenyl)sulfonylpiperidin-4-yl]but-3-en-1-ol.
| Compound Name | 1-[4-benzyl-1-(4-methylphenyl)sulfonylpiperidin-4-yl]but-3-en-1-ol |
|---|---|
| PubChem CID | 171048440 |
| Molecular Formula | C23H29NO3S |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 1-[4-benzyl-1-(4-methylphenyl)sulfonylpiperidin-4-yl]but-3-en-1-ol |
| SMILES | C=CCC(O)C1(Cc2ccccc2)CCN(S(=O)(=O)c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C23H29NO3S/c1-3-7-22(25)23(18-20-8-5-4-6-9-20)14-16-24(17-15-23)28(26,27)21-12-10-19(2)11-13-21/h3-6,8-13,22,25H,1,7,14-18H2,2H3 |
| InChIKey | AAQOPTWSUNIWKT-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|