C26H27NO2S — CID 25147241
1-(4-methylphenyl)sulfonyl-4-phenyl-4-(1-phenylethenyl)piperidine (PubChem CID 25147241) has the molecular formula C26H27NO2S and a molecular weight of 417.57 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-4-phenyl-4-(1-phenylethenyl)piperidine.
| Compound Name | 1-(4-methylphenyl)sulfonyl-4-phenyl-4-(1-phenylethenyl)piperidine |
|---|---|
| PubChem CID | 25147241 |
| Molecular Formula | C26H27NO2S |
| Molecular Weight | 417.57 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-4-phenyl-4-(1-phenylethenyl)piperidine |
| SMILES | C=C(c1ccccc1)C1(c2ccccc2)CCN(S(=O)(=O)c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C26H27NO2S/c1-21-13-15-25(16-14-21)30(28,29)27-19-17-26(18-20-27,24-11-7-4-8-12-24)22(2)23-9-5-3-6-10-23/h3-16H,2,17-20H2,1H3 |
| InChIKey | XTJUVMIEDRYGAB-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.57 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |