C25H25NO4S — CID 135019799
[(4S)-4-hydroxy-1-(4-methylphenyl)sulfonyl-4-phenylpiperidin-3-yl]-phenylmethanone (PubChem CID 135019799) has the molecular formula C25H25NO4S and a molecular weight of 435.55 g/mol. Its IUPAC name is [(4S)-4-hydroxy-1-(4-methylphenyl)sulfonyl-4-phenylpiperidin-3-yl]-phenylmethanone.
| Compound Name | [(4S)-4-hydroxy-1-(4-methylphenyl)sulfonyl-4-phenylpiperidin-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 135019799 |
| Molecular Formula | C25H25NO4S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | [(4S)-4-hydroxy-1-(4-methylphenyl)sulfonyl-4-phenylpiperidin-3-yl]-phenylmethanone |
| SMILES | Cc1ccc(S(=O)(=O)N2CC[C@@](O)(c3ccccc3)C(C(=O)c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C25H25NO4S/c1-19-12-14-22(15-13-19)31(29,30)26-17-16-25(28,21-10-6-3-7-11-21)23(18-26)24(27)20-8-4-2-5-9-20/h2-15,23,28H,16-18H2,1H3/t23?,25-/m1/s1 |
| InChIKey | KYFFUGBJDPNZBD-XSWBTSGESA-N |
| XLogP | 3.78 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |