C19H23NO5S — CID 86242091
4-(3-methoxyphenyl)-1-(4-methylphenyl)sulfonylpiperidine-3,4-diol (PubChem CID 86242091) has the molecular formula C19H23NO5S and a molecular weight of 377.46 g/mol. Its IUPAC name is 4-(3-methoxyphenyl)-1-(4-methylphenyl)sulfonylpiperidine-3,4-diol.
| Compound Name | 4-(3-methoxyphenyl)-1-(4-methylphenyl)sulfonylpiperidine-3,4-diol |
|---|---|
| PubChem CID | 86242091 |
| Molecular Formula | C19H23NO5S |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 4-(3-methoxyphenyl)-1-(4-methylphenyl)sulfonylpiperidine-3,4-diol |
| SMILES | COc1cccc(C2(O)CCN(S(=O)(=O)c3ccc(C)cc3)CC2O)c1 |
| InChI | InChI=1S/C19H23NO5S/c1-14-6-8-17(9-7-14)26(23,24)20-11-10-19(22,18(21)13-20)15-4-3-5-16(12-15)25-2/h3-9,12,18,21-22H,10-11,13H2,1-2H3 |
| InChIKey | NGVSSCCLPAHGHX-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |