C20H22ClNO3S — CID 74935523
3-methyl-1-(4-methylphenyl)sulfonyl-4-phenylpiperidine-4-carbonyl chloride (PubChem CID 74935523) has the molecular formula C20H22ClNO3S and a molecular weight of 391.92 g/mol. Its IUPAC name is 3-methyl-1-(4-methylphenyl)sulfonyl-4-phenylpiperidine-4-carbonyl chloride.
| Compound Name | 3-methyl-1-(4-methylphenyl)sulfonyl-4-phenylpiperidine-4-carbonyl chloride |
|---|---|
| PubChem CID | 74935523 |
| Molecular Formula | C20H22ClNO3S |
| Molecular Weight | 391.92 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 3-methyl-1-(4-methylphenyl)sulfonyl-4-phenylpiperidine-4-carbonyl chloride |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(C(=O)Cl)(c3ccccc3)C(C)C2)cc1 |
| InChI | InChI=1S/C20H22ClNO3S/c1-15-8-10-18(11-9-15)26(24,25)22-13-12-20(19(21)23,16(2)14-22)17-6-4-3-5-7-17/h3-11,16H,12-14H2,1-2H3 |
| InChIKey | GVTKVMZWJIVGTO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.92 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|