C20H22ClNO4S — CID 20511849
4-(3-chloro-2-methylphenyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carboxylic acid (PubChem CID 20511849) has the molecular formula C20H22ClNO4S and a molecular weight of 407.92 g/mol. Its IUPAC name is 4-(3-chloro-2-methylphenyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carboxylic acid.
| Compound Name | 4-(3-chloro-2-methylphenyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 20511849 |
| Molecular Formula | C20H22ClNO4S |
| Molecular Weight | 407.92 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | 4-(3-chloro-2-methylphenyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carboxylic acid |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(C(=O)O)(c3cccc(Cl)c3C)CC2)cc1 |
| InChI | InChI=1S/C20H22ClNO4S/c1-14-6-8-16(9-7-14)27(25,26)22-12-10-20(11-13-22,19(23)24)17-4-3-5-18(21)15(17)2/h3-9H,10-13H2,1-2H3,(H,23,24) |
| InChIKey | ZPMQDIHZFCJQON-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.92 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |