C17H14F3NO3S — CID 101256658
[(2S)-1-(4-methylphenyl)sulfonyl-2-(trifluoromethyl)aziridin-2-yl]-phenylmethanone (PubChem CID 101256658) has the molecular formula C17H14F3NO3S and a molecular weight of 369.36 g/mol. Its IUPAC name is [(2S)-1-(4-methylphenyl)sulfonyl-2-(trifluoromethyl)aziridin-2-yl]-phenylmethanone.
| Compound Name | [(2S)-1-(4-methylphenyl)sulfonyl-2-(trifluoromethyl)aziridin-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 101256658 |
| Molecular Formula | C17H14F3NO3S |
| Molecular Weight | 369.36 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | [(2S)-1-(4-methylphenyl)sulfonyl-2-(trifluoromethyl)aziridin-2-yl]-phenylmethanone |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@]2(C(=O)c2ccccc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H14F3NO3S/c1-12-7-9-14(10-8-12)25(23,24)21-11-16(21,17(18,19)20)15(22)13-5-3-2-4-6-13/h2-10H,11H2,1H3/t16-,21?/m0/s1 |
| InChIKey | BAHXLTNOFNUDFW-BJQOMGFOSA-N |
| XLogP | 3.18 |
| TPSA | 54.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|