C16H18F3NO4S — CID 7298626
methyl (6S)-1-(benzenesulfonyl)-3,4-dimethyl-6-(trifluoromethyl)-2,5-dihydropyridine-6-carboxylate (PubChem CID 7298626) has the molecular formula C16H18F3NO4S and a molecular weight of 377.38 g/mol. Its IUPAC name is methyl (6S)-1-(benzenesulfonyl)-3,4-dimethyl-6-(trifluoromethyl)-2,5-dihydropyridine-6-carboxylate.
| Compound Name | methyl (6S)-1-(benzenesulfonyl)-3,4-dimethyl-6-(trifluoromethyl)-2,5-dihydropyridine-6-carboxylate |
|---|---|
| PubChem CID | 7298626 |
| Molecular Formula | C16H18F3NO4S |
| Molecular Weight | 377.38 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | methyl (6S)-1-(benzenesulfonyl)-3,4-dimethyl-6-(trifluoromethyl)-2,5-dihydropyridine-6-carboxylate |
| SMILES | COC(=O)[C@]1(C(F)(F)F)CC(C)=C(C)CN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H18F3NO4S/c1-11-9-15(14(21)24-3,16(17,18)19)20(10-12(11)2)25(22,23)13-7-5-4-6-8-13/h4-8H,9-10H2,1-3H3/t15-/m0/s1 |
| InChIKey | DXWBNFRYRMBPHV-HNNXBMFYSA-N |
| XLogP | 2.89 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|