C23H22F3NO8S — CID 15487687
4-O,5-O-diethyl 1-O-methyl 2-(benzenesulfonyl)-1-(trifluoromethyl)-3H-isoindole-1,4,5-tricarboxylate (PubChem CID 15487687) has the molecular formula C23H22F3NO8S and a molecular weight of 529.49 g/mol. Its IUPAC name is 4-O,5-O-diethyl 1-O-methyl 2-(benzenesulfonyl)-1-(trifluoromethyl)-3H-isoindole-1,4,5-tricarboxylate.
| Compound Name | 4-O,5-O-diethyl 1-O-methyl 2-(benzenesulfonyl)-1-(trifluoromethyl)-3H-isoindole-1,4,5-tricarboxylate |
|---|---|
| PubChem CID | 15487687 |
| Molecular Formula | C23H22F3NO8S |
| Molecular Weight | 529.49 g/mol |
| Exact Mass | 529.10 |
| IUPAC Name | 4-O,5-O-diethyl 1-O-methyl 2-(benzenesulfonyl)-1-(trifluoromethyl)-3H-isoindole-1,4,5-tricarboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1C(=O)OCC)CN(S(=O)(=O)c1ccccc1)C2(C(=O)OC)C(F)(F)F |
| InChI | InChI=1S/C23H22F3NO8S/c1-4-34-19(28)15-11-12-17-16(18(15)20(29)35-5-2)13-27(22(17,21(30)33-3)23(24,25)26)36(31,32)14-9-7-6-8-10-14/h6-12H,4-5,13H2,1-3H3 |
| InChIKey | VTVFPNLODLEMDO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 116.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.49 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|