C15H18O5S2 — CID 134924374
methyl 6-(benzenesulfonyl)-3,4-dimethyl-1-oxo-2,5-dihydrothiopyran-6-carboxylate (PubChem CID 134924374) has the molecular formula C15H18O5S2 and a molecular weight of 342.44 g/mol. Its IUPAC name is methyl 6-(benzenesulfonyl)-3,4-dimethyl-1-oxo-2,5-dihydrothiopyran-6-carboxylate.
| Compound Name | methyl 6-(benzenesulfonyl)-3,4-dimethyl-1-oxo-2,5-dihydrothiopyran-6-carboxylate |
|---|---|
| PubChem CID | 134924374 |
| Molecular Formula | C15H18O5S2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | methyl 6-(benzenesulfonyl)-3,4-dimethyl-1-oxo-2,5-dihydrothiopyran-6-carboxylate |
| SMILES | COC(=O)C1(S(=O)(=O)c2ccccc2)CC(C)=C(C)CS1=O |
| InChI | InChI=1S/C15H18O5S2/c1-11-9-15(14(16)20-3,21(17)10-12(11)2)22(18,19)13-7-5-4-6-8-13/h4-8H,9-10H2,1-3H3 |
| InChIKey | BHGVWCKNBAOWOH-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|