C19H26FNO4S — CID 11090272
[(1S,6R)-6-(benzenesulfonyl)-6-fluoro-3,4-dimethylcyclohex-3-en-1-yl] N,N-diethylcarbamate (PubChem CID 11090272) has the molecular formula C19H26FNO4S and a molecular weight of 383.49 g/mol. Its IUPAC name is [(1S,6R)-6-(benzenesulfonyl)-6-fluoro-3,4-dimethylcyclohex-3-en-1-yl] N,N-diethylcarbamate.
| Compound Name | [(1S,6R)-6-(benzenesulfonyl)-6-fluoro-3,4-dimethylcyclohex-3-en-1-yl] N,N-diethylcarbamate |
|---|---|
| PubChem CID | 11090272 |
| Molecular Formula | C19H26FNO4S |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | [(1S,6R)-6-(benzenesulfonyl)-6-fluoro-3,4-dimethylcyclohex-3-en-1-yl] N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)O[C@H]1CC(C)=C(C)C[C@@]1(F)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H26FNO4S/c1-5-21(6-2)18(22)25-17-12-14(3)15(4)13-19(17,20)26(23,24)16-10-8-7-9-11-16/h7-11,17H,5-6,12-13H2,1-4H3/t17-,19+/m0/s1 |
| InChIKey | UHIGYYCVBQINDA-PKOBYXMFSA-N |
| XLogP | 4.10 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|